C14H28F3NO — CID 62724244
2,2-diethyl-N-propyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine (PubChem CID 62724244) has the molecular formula C14H28F3NO and a molecular weight of 283.38 g/mol. Its IUPAC name is 2,2-diethyl-N-propyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine.
| Compound Name | 2,2-diethyl-N-propyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
|---|---|
| PubChem CID | 62724244 |
| Molecular Formula | C14H28F3NO |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 2,2-diethyl-N-propyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
| SMILES | CCCNCC(CC)(CC)CCCOCC(F)(F)F |
| InChI | InChI=1S/C14H28F3NO/c1-4-9-18-11-13(5-2,6-3)8-7-10-19-12-14(15,16)17/h18H,4-12H2,1-3H3 |
| InChIKey | QEVPKPGIAKASGF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|