C11H19Br2F3O — CID 79455454
4,4-bis(bromomethyl)-1-(2,2,2-trifluoroethoxy)heptane (PubChem CID 79455454) has the molecular formula C11H19Br2F3O and a molecular weight of 384.07 g/mol. Its IUPAC name is 4,4-bis(bromomethyl)-1-(2,2,2-trifluoroethoxy)heptane.
| Compound Name | 4,4-bis(bromomethyl)-1-(2,2,2-trifluoroethoxy)heptane |
|---|---|
| PubChem CID | 79455454 |
| Molecular Formula | C11H19Br2F3O |
| Molecular Weight | 384.07 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 4,4-bis(bromomethyl)-1-(2,2,2-trifluoroethoxy)heptane |
| SMILES | CCCC(CBr)(CBr)CCCOCC(F)(F)F |
| InChI | InChI=1S/C11H19Br2F3O/c1-2-4-10(7-12,8-13)5-3-6-17-9-11(14,15)16/h2-9H2,1H3 |
| InChIKey | CIHHLCUXXJBYLO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.07 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|