About ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde
ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde (PubChem CID 91139284) has the molecular formula C19H31O7PS
and a molecular weight of 434.49 g/mol. Its IUPAC name is ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde.
Molecular Properties
| Compound Name | ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde |
| PubChem CID | 91139284 |
| Molecular Formula | C19H31O7PS |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde |
| SMILES | CCOC(=O)C(CC)P(=O)(OCC)OCC.COc1cc(C=O)ccc1SC |
| InChI | InChI=1S/C10H21O5P.C9H10O2S/c1-5-9(10(11)13-6-2)16(12,14-7-3)15-8-4;1-11-8-5-7(6-10)3-4-9(8)12-2/h9H,5-8H2,1-4H3;3-6H,1-2H3 |
| InChIKey | NPGKKGVREXUSSQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde?
The IUPAC name of ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde (CID 91139284) is ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde.
What is the SMILES notation for ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde?
The canonical SMILES for ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde is CCOC(=O)C(CC)P(=O)(OCC)OCC.COc1cc(C=O)ccc1SC.
What is the InChIKey of ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde?
The InChIKey is NPGKKGVREXUSSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21O5P.C9H10O2S/c1-5-9(10(11)13-6-2)16(12,14-7-3)15-8-4;1-11-8-5-7(6-10)3-4-9(8)12-2/h9H,5-8H2,1-4H3;3-6H,1-2H3.
What are the key properties of ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde?
ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde has a molecular weight of 434.49 g/mol, XLogP of 4.82, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-diethoxyphosphorylbutanoate;3-methoxy-4-methylsulfanylbenzaldehyde is sourced from PubChem (CID 91139284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).