C21H21NO7 — CID 163364809
ethyl (E)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;4-hydroxy-3-methoxybenzaldehyde (PubChem CID 163364809) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;4-hydroxy-3-methoxybenzaldehyde.
| Compound Name | ethyl (E)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;4-hydroxy-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 163364809 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | ethyl (E)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;4-hydroxy-3-methoxybenzaldehyde |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(O)c(OC)c1.COc1cc(C=O)ccc1O |
| InChI | InChI=1S/C13H13NO4.C8H8O3/c1-3-18-13(16)10(8-14)6-9-4-5-11(15)12(7-9)17-2;1-11-8-4-6(5-9)2-3-7(8)10/h4-7,15H,3H2,1-2H3;2-5,10H,1H3/b10-6+; |
| InChIKey | STMUWZUCGZSDRU-AAGWESIMSA-N |
| XLogP | 3.08 |
| TPSA | 126.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|