C10H11F3O5S — CID 59157356
[2-(1,4-oxathian-2-yloxy)-2-oxoethyl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 59157356) has the molecular formula C10H11F3O5S and a molecular weight of 300.25 g/mol. Its IUPAC name is [2-(1,4-oxathian-2-yloxy)-2-oxoethyl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [2-(1,4-oxathian-2-yloxy)-2-oxoethyl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 59157356 |
| Molecular Formula | C10H11F3O5S |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | [2-(1,4-oxathian-2-yloxy)-2-oxoethyl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OCC(=O)OC1CSCCO1)C(F)(F)F |
| InChI | InChI=1S/C10H11F3O5S/c1-6(10(11,12)13)9(15)17-4-7(14)18-8-5-19-3-2-16-8/h8H,1-5H2 |
| InChIKey | KTJBZYVMHKJETD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|