C13H22O5S — CID 143850767
ethane;[1-(1,4-oxathian-2-yloxy)-1-oxopropan-2-yl] 2-methylprop-2-enoate (PubChem CID 143850767) has the molecular formula C13H22O5S and a molecular weight of 290.38 g/mol. Its IUPAC name is ethane;[1-(1,4-oxathian-2-yloxy)-1-oxopropan-2-yl] 2-methylprop-2-enoate.
| Compound Name | ethane;[1-(1,4-oxathian-2-yloxy)-1-oxopropan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 143850767 |
| Molecular Formula | C13H22O5S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | ethane;[1-(1,4-oxathian-2-yloxy)-1-oxopropan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C(=O)OC1CSCCO1.CC |
| InChI | InChI=1S/C11H16O5S.C2H6/c1-7(2)10(12)15-8(3)11(13)16-9-6-17-5-4-14-9;1-2/h8-9H,1,4-6H2,2-3H3;1-2H3 |
| InChIKey | FRNMOTLHSRMHRR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|