C12H18O4S2 — CID 59638161
[1-[(2-methyl-1,4-dithian-2-yl)oxy]-1-oxopropan-2-yl] 2-methylprop-2-enoate (PubChem CID 59638161) has the molecular formula C12H18O4S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is [1-[(2-methyl-1,4-dithian-2-yl)oxy]-1-oxopropan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-[(2-methyl-1,4-dithian-2-yl)oxy]-1-oxopropan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59638161 |
| Molecular Formula | C12H18O4S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | [1-[(2-methyl-1,4-dithian-2-yl)oxy]-1-oxopropan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C(=O)OC1(C)CSCCS1 |
| InChI | InChI=1S/C12H18O4S2/c1-8(2)10(13)15-9(3)11(14)16-12(4)7-17-5-6-18-12/h9H,1,5-7H2,2-4H3 |
| InChIKey | IHPHLYNRLFDXDY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|