C10H14O4S2 — CID 59638156
[2-[(2-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] prop-2-enoate (PubChem CID 59638156) has the molecular formula C10H14O4S2 and a molecular weight of 262.35 g/mol. Its IUPAC name is [2-[(2-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] prop-2-enoate.
| Compound Name | [2-[(2-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] prop-2-enoate |
|---|---|
| PubChem CID | 59638156 |
| Molecular Formula | C10H14O4S2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | [2-[(2-methyl-1,4-dithian-2-yl)oxy]-2-oxoethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)OC1(C)CSCCS1 |
| InChI | InChI=1S/C10H14O4S2/c1-3-8(11)13-6-9(12)14-10(2)7-15-4-5-16-10/h3H,1,4-7H2,2H3 |
| InChIKey | ZRLRTOQSCLFMKB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|