C11H16O2S2 — CID 102477095
1,4-dithiaspiro[4.4]nonan-9-ylmethyl prop-2-enoate (PubChem CID 102477095) has the molecular formula C11H16O2S2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1,4-dithiaspiro[4.4]nonan-9-ylmethyl prop-2-enoate.
| Compound Name | 1,4-dithiaspiro[4.4]nonan-9-ylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 102477095 |
| Molecular Formula | C11H16O2S2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 1,4-dithiaspiro[4.4]nonan-9-ylmethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1CCCC12SCCS2 |
| InChI | InChI=1S/C11H16O2S2/c1-2-10(12)13-8-9-4-3-5-11(9)14-6-7-15-11/h2,9H,1,3-8H2 |
| InChIKey | HRFBDSOXBZZAKQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|