C17H30O5 — CID 118386791
[1,2,2-tris(hydroxymethyl)cyclodecyl]methyl prop-2-enoate (PubChem CID 118386791) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is [1,2,2-tris(hydroxymethyl)cyclodecyl]methyl prop-2-enoate.
| Compound Name | [1,2,2-tris(hydroxymethyl)cyclodecyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 118386791 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | [1,2,2-tris(hydroxymethyl)cyclodecyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(CO)CCCCCCCCC1(CO)CO |
| InChI | InChI=1S/C17H30O5/c1-2-15(21)22-14-17(13-20)10-8-6-4-3-5-7-9-16(17,11-18)12-19/h2,18-20H,1,3-14H2 |
| InChIKey | ZGUDXMGGBZMDLC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|