C15H26O5 — CID 174637814
ethenoxyethene;[1-(hydroxymethyl)cyclohexyl]methanol;prop-2-enoic acid (PubChem CID 174637814) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is ethenoxyethene;[1-(hydroxymethyl)cyclohexyl]methanol;prop-2-enoic acid.
| Compound Name | ethenoxyethene;[1-(hydroxymethyl)cyclohexyl]methanol;prop-2-enoic acid |
|---|---|
| PubChem CID | 174637814 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | ethenoxyethene;[1-(hydroxymethyl)cyclohexyl]methanol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.C=COC=C.OCC1(CO)CCCCC1 |
| InChI | InChI=1S/C8H16O2.C4H6O.C3H4O2/c9-6-8(7-10)4-2-1-3-5-8;1-3-5-4-2;1-2-3(4)5/h9-10H,1-7H2;3-4H,1-2H2;2H,1H2,(H,4,5) |
| InChIKey | IEWFTJVKDJVULV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|