C11H11F5O5 — CID 89072491
3,3-difluoro-5-methyl-5-(prop-2-enoyloxymethyl)-2-(trifluoromethyl)oxolane-2-carboxylic acid (PubChem CID 89072491) has the molecular formula C11H11F5O5 and a molecular weight of 318.19 g/mol. Its IUPAC name is 3,3-difluoro-5-methyl-5-(prop-2-enoyloxymethyl)-2-(trifluoromethyl)oxolane-2-carboxylic acid.
| Compound Name | 3,3-difluoro-5-methyl-5-(prop-2-enoyloxymethyl)-2-(trifluoromethyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 89072491 |
| Molecular Formula | C11H11F5O5 |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3,3-difluoro-5-methyl-5-(prop-2-enoyloxymethyl)-2-(trifluoromethyl)oxolane-2-carboxylic acid |
| SMILES | C=CC(=O)OCC1(C)CC(F)(F)C(C(=O)O)(C(F)(F)F)O1 |
| InChI | InChI=1S/C11H11F5O5/c1-3-6(17)20-5-8(2)4-9(12,13)10(21-8,7(18)19)11(14,15)16/h3H,1,4-5H2,2H3,(H,18,19) |
| InChIKey | MGVOEWCQVZFWCU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|