C9H14O3 — CID 174904859
(2,3-dimethyloxetan-2-yl)methyl prop-2-enoate (PubChem CID 174904859) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (2,3-dimethyloxetan-2-yl)methyl prop-2-enoate.
| Compound Name | (2,3-dimethyloxetan-2-yl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 174904859 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (2,3-dimethyloxetan-2-yl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(C)OCC1C |
| InChI | InChI=1S/C9H14O3/c1-4-8(10)11-6-9(3)7(2)5-12-9/h4,7H,1,5-6H2,2-3H3 |
| InChIKey | QEXWCSBFVXPFSY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|