C22H28O9 — CID 68606821
[2-hydroxy-1,3,3-tris(prop-2-enoyloxymethyl)cyclohexyl]methyl prop-2-enoate (PubChem CID 68606821) has the molecular formula C22H28O9 and a molecular weight of 436.46 g/mol. Its IUPAC name is [2-hydroxy-1,3,3-tris(prop-2-enoyloxymethyl)cyclohexyl]methyl prop-2-enoate.
| Compound Name | [2-hydroxy-1,3,3-tris(prop-2-enoyloxymethyl)cyclohexyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 68606821 |
| Molecular Formula | C22H28O9 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [2-hydroxy-1,3,3-tris(prop-2-enoyloxymethyl)cyclohexyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(COC(=O)C=C)CCCC(COC(=O)C=C)(COC(=O)C=C)C1O |
| InChI | InChI=1S/C22H28O9/c1-5-16(23)28-12-21(13-29-17(24)6-2)10-9-11-22(20(21)27,14-30-18(25)7-3)15-31-19(26)8-4/h5-8,20,27H,1-4,9-15H2 |
| InChIKey | IMGCCWSVSCLFBR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|