C26H22F12O8 — CID 89194736
[1,2,3,4,4a,5,6,6,7,7,8,8a-dodecafluoro-4,5,8-tris(prop-2-enoyloxymethyl)-2,3-dihydronaphthalen-1-yl]methyl prop-2-enoate (PubChem CID 89194736) has the molecular formula C26H22F12O8 and a molecular weight of 690.43 g/mol. Its IUPAC name is [1,2,3,4,4a,5,6,6,7,7,8,8a-dodecafluoro-4,5,8-tris(prop-2-enoyloxymethyl)-2,3-dihydronaphthalen-1-yl]methyl prop-2-enoate.
| Compound Name | [1,2,3,4,4a,5,6,6,7,7,8,8a-dodecafluoro-4,5,8-tris(prop-2-enoyloxymethyl)-2,3-dihydronaphthalen-1-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 89194736 |
| Molecular Formula | C26H22F12O8 |
| Molecular Weight | 690.43 g/mol |
| Exact Mass | 690.11 |
| IUPAC Name | [1,2,3,4,4a,5,6,6,7,7,8,8a-dodecafluoro-4,5,8-tris(prop-2-enoyloxymethyl)-2,3-dihydronaphthalen-1-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(F)C(F)C(F)C(F)(COC(=O)C=C)C2(F)C(F)(COC(=O)C=C)C(F)(F)C(F)(F)C(F)(COC(=O)C=C)C12F |
| InChI | InChI=1S/C26H22F12O8/c1-5-13(39)43-9-19(29)17(27)18(28)20(30,10-44-14(40)6-2)24(34)22(32,12-46-16(42)8-4)26(37,38)25(35,36)21(31,23(19,24)33)11-45-15(41)7-3/h5-8,17-18H,1-4,9-12H2 |
| InChIKey | CTRPAESIAOQZFJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|