C10H8F8O4 — CID 166810414
[4,4-difluoro-5-hydroxy-3,5-bis(trifluoromethyl)oxolan-3-yl]methyl prop-2-enoate (PubChem CID 166810414) has the molecular formula C10H8F8O4 and a molecular weight of 344.15 g/mol. Its IUPAC name is [4,4-difluoro-5-hydroxy-3,5-bis(trifluoromethyl)oxolan-3-yl]methyl prop-2-enoate.
| Compound Name | [4,4-difluoro-5-hydroxy-3,5-bis(trifluoromethyl)oxolan-3-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 166810414 |
| Molecular Formula | C10H8F8O4 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | [4,4-difluoro-5-hydroxy-3,5-bis(trifluoromethyl)oxolan-3-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(C(F)(F)F)COC(O)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C10H8F8O4/c1-2-5(19)21-3-6(9(13,14)15)4-22-8(20,7(6,11)12)10(16,17)18/h2,20H,1,3-4H2 |
| InChIKey | FAYGMOYFGZEIBP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|