C9H7F7O4 — CID 166810413
[2,2,4,4-tetrafluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-3-yl] prop-2-enoate (PubChem CID 166810413) has the molecular formula C9H7F7O4 and a molecular weight of 312.14 g/mol. Its IUPAC name is [2,2,4,4-tetrafluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-3-yl] prop-2-enoate.
| Compound Name | [2,2,4,4-tetrafluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 166810413 |
| Molecular Formula | C9H7F7O4 |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | [2,2,4,4-tetrafluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1(C)C(F)(F)OC(O)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C9H7F7O4/c1-3-4(17)19-5(2)6(10,11)7(18,8(12,13)14)20-9(5,15)16/h3,18H,1H2,2H3 |
| InChIKey | BWSYHFHLRBPNHE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|