C9H8F10O3 — CID 89153091
3,3,5,5-tetrafluoro-4,6-dimethyl-2,6-bis(trifluoromethyl)oxane-2,4-diol (PubChem CID 89153091) has the molecular formula C9H8F10O3 and a molecular weight of 354.14 g/mol. Its IUPAC name is 3,3,5,5-tetrafluoro-4,6-dimethyl-2,6-bis(trifluoromethyl)oxane-2,4-diol.
| Compound Name | 3,3,5,5-tetrafluoro-4,6-dimethyl-2,6-bis(trifluoromethyl)oxane-2,4-diol |
|---|---|
| PubChem CID | 89153091 |
| Molecular Formula | C9H8F10O3 |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 3,3,5,5-tetrafluoro-4,6-dimethyl-2,6-bis(trifluoromethyl)oxane-2,4-diol |
| SMILES | CC1(O)C(F)(F)C(C)(C(F)(F)F)OC(O)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C9H8F10O3/c1-3(20)5(10,11)4(2,8(14,15)16)22-7(21,6(3,12)13)9(17,18)19/h20-21H,1-2H3 |
| InChIKey | QSFZHTORCYOVFI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |