C21H28F10O4 — CID 140503278
[4-cyclohexyl-2-ethyl-3,3,5,5-tetrafluoro-6-hydroxy-2,6-bis(trifluoromethyl)oxan-4-yl] 2,2-dimethylbutanoate (PubChem CID 140503278) has the molecular formula C21H28F10O4 and a molecular weight of 534.43 g/mol. Its IUPAC name is [4-cyclohexyl-2-ethyl-3,3,5,5-tetrafluoro-6-hydroxy-2,6-bis(trifluoromethyl)oxan-4-yl] 2,2-dimethylbutanoate.
| Compound Name | [4-cyclohexyl-2-ethyl-3,3,5,5-tetrafluoro-6-hydroxy-2,6-bis(trifluoromethyl)oxan-4-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 140503278 |
| Molecular Formula | C21H28F10O4 |
| Molecular Weight | 534.43 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | [4-cyclohexyl-2-ethyl-3,3,5,5-tetrafluoro-6-hydroxy-2,6-bis(trifluoromethyl)oxan-4-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C2CCCCC2)C(F)(F)C(O)(C(F)(F)F)OC(CC)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C21H28F10O4/c1-5-14(3,4)13(32)34-16(12-10-8-7-9-11-12)17(22,23)15(6-2,20(26,27)28)35-19(33,18(16,24)25)21(29,30)31/h12,33H,5-11H2,1-4H3 |
| InChIKey | GJSZCGLZSNXJBB-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.43 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |