C13H19F5O5 — CID 121274478
[4,4-difluoro-5-(hydroperoxymethyl)-3-methyl-5-(trifluoromethyl)oxolan-3-yl] 2,2-dimethylbutanoate (PubChem CID 121274478) has the molecular formula C13H19F5O5 and a molecular weight of 350.28 g/mol. Its IUPAC name is [4,4-difluoro-5-(hydroperoxymethyl)-3-methyl-5-(trifluoromethyl)oxolan-3-yl] 2,2-dimethylbutanoate.
| Compound Name | [4,4-difluoro-5-(hydroperoxymethyl)-3-methyl-5-(trifluoromethyl)oxolan-3-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 121274478 |
| Molecular Formula | C13H19F5O5 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | [4,4-difluoro-5-(hydroperoxymethyl)-3-methyl-5-(trifluoromethyl)oxolan-3-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)COC(COO)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C13H19F5O5/c1-5-9(2,3)8(19)23-10(4)6-21-11(7-22-20,12(10,14)15)13(16,17)18/h20H,5-7H2,1-4H3 |
| InChIKey | XBVIHOFVDVMTSJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|