About (1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate
(1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate (PubChem CID 159484078) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is (1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate.
Analyze (1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate?
The IUPAC name of (1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate (CID 159484078) is (1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate.
What is the SMILES notation for (1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate?
The canonical SMILES for (1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC1(C)CCC2CC21C.
What is the InChIKey of (1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate?
The InChIKey is PEPDUTGXLMQQLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-6-12(2,3)11(15)16-14(5)8-7-10-9-13(10,14)4/h10H,6-9H2,1-5H3.
What are the key properties of (1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate?
(1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate has a molecular weight of 224.34 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dimethyl-2-bicyclo[3.1.0]hexanyl) 2,2-dimethylbutanoate is sourced from PubChem (CID 159484078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).