C17H32O2 — CID 163658734
(1,2,2,3,3,4-hexamethylcyclopentyl) 2,2-dimethylbutanoate (PubChem CID 163658734) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (1,2,2,3,3,4-hexamethylcyclopentyl) 2,2-dimethylbutanoate.
| Compound Name | (1,2,2,3,3,4-hexamethylcyclopentyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 163658734 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (1,2,2,3,3,4-hexamethylcyclopentyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)CC(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C17H32O2/c1-10-14(3,4)13(18)19-17(9)11-12(2)15(5,6)16(17,7)8/h12H,10-11H2,1-9H3 |
| InChIKey | ISNRLLZKZMJPMB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |