C21H36O2 — CID 59038763
[(1S,2R,8R)-2,6,6,8-tetramethyl-8-tricyclo[5.3.1.01,5]undecanyl] 2,2-dimethylbutanoate (PubChem CID 59038763) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is [(1S,2R,8R)-2,6,6,8-tetramethyl-8-tricyclo[5.3.1.01,5]undecanyl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,2R,8R)-2,6,6,8-tetramethyl-8-tricyclo[5.3.1.01,5]undecanyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59038763 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | [(1S,2R,8R)-2,6,6,8-tetramethyl-8-tricyclo[5.3.1.01,5]undecanyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@]1(C)CC[C@@]23CC1C(C)(C)C2CC[C@H]3C |
| InChI | InChI=1S/C21H36O2/c1-8-18(3,4)17(22)23-20(7)11-12-21-13-16(20)19(5,6)15(21)10-9-14(21)2/h14-16H,8-13H2,1-7H3/t14-,15?,16?,20-,21+/m1/s1 |
| InChIKey | DSBDPGGIQRQMJK-LPQLGVJJSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |