C29H40O5 — CID 174240211
[2-hydroxy-4-[(E)-3-oxo-3-[[(1S,2S,5S,7S,8S)-2,6,6,8-tetramethyl-8-tricyclo[5.3.1.01,5]undecanyl]oxy]prop-1-enyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 174240211) has the molecular formula C29H40O5 and a molecular weight of 468.63 g/mol. Its IUPAC name is [2-hydroxy-4-[(E)-3-oxo-3-[[(1S,2S,5S,7S,8S)-2,6,6,8-tetramethyl-8-tricyclo[5.3.1.01,5]undecanyl]oxy]prop-1-enyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [2-hydroxy-4-[(E)-3-oxo-3-[[(1S,2S,5S,7S,8S)-2,6,6,8-tetramethyl-8-tricyclo[5.3.1.01,5]undecanyl]oxy]prop-1-enyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174240211 |
| Molecular Formula | C29H40O5 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | [2-hydroxy-4-[(E)-3-oxo-3-[[(1S,2S,5S,7S,8S)-2,6,6,8-tetramethyl-8-tricyclo[5.3.1.01,5]undecanyl]oxy]prop-1-enyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H]1CC[C@H]2C(C)(C)[C@@H]3C[C@@]12CC[C@]3(C)OC(=O)/C=C/c1ccc(OC(=O)C(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C29H40O5/c1-18-8-12-22-27(5,6)23-17-29(18,22)15-14-28(23,7)34-24(31)13-10-19-9-11-21(20(30)16-19)33-25(32)26(2,3)4/h9-11,13,16,18,22-23,30H,8,12,14-15,17H2,1-7H3/b13-10+/t18-,22-,23-,28-,29-/m0/s1 |
| InChIKey | OLLXWKGYEVVGAN-DZSYKKIBSA-N |
| XLogP | 6.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|