C32H32O5 — CID 87867859
[1-[6-[(E)-3-[(2S)-butan-2-yl]oxy-3-oxoprop-1-enyl]-2-hydroxynaphthalen-1-yl]naphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 87867859) has the molecular formula C32H32O5 and a molecular weight of 496.60 g/mol. Its IUPAC name is [1-[6-[(E)-3-[(2S)-butan-2-yl]oxy-3-oxoprop-1-enyl]-2-hydroxynaphthalen-1-yl]naphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [1-[6-[(E)-3-[(2S)-butan-2-yl]oxy-3-oxoprop-1-enyl]-2-hydroxynaphthalen-1-yl]naphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87867859 |
| Molecular Formula | C32H32O5 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | [1-[6-[(E)-3-[(2S)-butan-2-yl]oxy-3-oxoprop-1-enyl]-2-hydroxynaphthalen-1-yl]naphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC[C@H](C)OC(=O)/C=C/c1ccc2c(-c3c(OC(=O)C(C)(C)C)ccc4ccccc34)c(O)ccc2c1 |
| InChI | InChI=1S/C32H32O5/c1-6-20(2)36-28(34)18-12-21-11-15-25-23(19-21)13-16-26(33)29(25)30-24-10-8-7-9-22(24)14-17-27(30)37-31(35)32(3,4)5/h7-20,33H,6H2,1-5H3/b18-12+/t20-/m0/s1 |
| InChIKey | FMJMVVXDVGKSTM-YWFITGJYSA-N |
| XLogP | 7.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|