C39H36N2O2 — CID 158977081
butan-2-yl 3-phenylprop-2-enoate;2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline (PubChem CID 158977081) has the molecular formula C39H36N2O2 and a molecular weight of 564.73 g/mol. Its IUPAC name is butan-2-yl 3-phenylprop-2-enoate;2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline.
| Compound Name | butan-2-yl 3-phenylprop-2-enoate;2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 158977081 |
| Molecular Formula | C39H36N2O2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | butan-2-yl 3-phenylprop-2-enoate;2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline |
| SMILES | CCC(C)OC(=O)C=Cc1ccccc1.Cc1cc(-c2ccccc2)c2ccc3c(-c4ccccc4)cc(C)nc3c2n1 |
| InChI | InChI=1S/C26H20N2.C13H16O2/c1-17-15-23(19-9-5-3-6-10-19)21-13-14-22-24(20-11-7-4-8-12-20)16-18(2)28-26(22)25(21)27-17;1-3-11(2)15-13(14)10-9-12-7-5-4-6-8-12/h3-16H,1-2H3;4-11H,3H2,1-2H3 |
| InChIKey | JONITHFBKDCVRS-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|