About butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide
butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide (PubChem CID 158903845) has the molecular formula C28H45NO3
and a molecular weight of 443.67 g/mol. Its IUPAC name is butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide.
Molecular Properties
| Compound Name | butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide |
| PubChem CID | 158903845 |
| Molecular Formula | C28H45NO3 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 443.34 |
| IUPAC Name | butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide |
| SMILES | C=CC(=O)NCCCCCCCCCCCC.CCC(C)OC(=O)/C=C\c1ccccc1 |
| InChI | InChI=1S/C15H29NO.C13H16O2/c1-3-5-6-7-8-9-10-11-12-13-14-16-15(17)4-2;1-3-11(2)15-13(14)10-9-12-7-5-4-6-8-12/h4H,2-3,5-14H2,1H3,(H,16,17);4-11H,3H2,1-2H3/b;10-9- |
| InChIKey | JFUBRJVMZZMUQT-SVMKZPJVSA-N |
| XLogP | 7.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide?
The IUPAC name of butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide (CID 158903845) is butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide.
What is the SMILES notation for butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide?
The canonical SMILES for butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide is C=CC(=O)NCCCCCCCCCCCC.CCC(C)OC(=O)/C=C\c1ccccc1.
What is the InChIKey of butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide?
The InChIKey is JFUBRJVMZZMUQT-SVMKZPJVSA-N. The full InChI is InChI=1S/C15H29NO.C13H16O2/c1-3-5-6-7-8-9-10-11-12-13-14-16-15(17)4-2;1-3-11(2)15-13(14)10-9-12-7-5-4-6-8-12/h4H,2-3,5-14H2,1H3,(H,16,17);4-11H,3H2,1-2H3/b;10-9-.
What are the key properties of butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide?
butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide has a molecular weight of 443.67 g/mol, XLogP of 7.25, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl (Z)-3-phenylprop-2-enoate;N-dodecylprop-2-enamide is sourced from PubChem (CID 158903845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).