C23H35NO — CID 70372352
(2E,6Z)-N-decyl-7-phenylhepta-2,6-dienamide (PubChem CID 70372352) has the molecular formula C23H35NO and a molecular weight of 341.54 g/mol. Its IUPAC name is (2E,6Z)-N-decyl-7-phenylhepta-2,6-dienamide.
| Compound Name | (2E,6Z)-N-decyl-7-phenylhepta-2,6-dienamide |
|---|---|
| PubChem CID | 70372352 |
| Molecular Formula | C23H35NO |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | (2E,6Z)-N-decyl-7-phenylhepta-2,6-dienamide |
| SMILES | CCCCCCCCCCNC(=O)/C=C/CC/C=C\c1ccccc1 |
| InChI | InChI=1S/C23H35NO/c1-2-3-4-5-6-7-10-16-21-24-23(25)20-15-9-8-12-17-22-18-13-11-14-19-22/h11-15,17-20H,2-10,16,21H2,1H3,(H,24,25)/b17-12-,20-15+ |
| InChIKey | QGWVNULSSIVJDM-HSMGORCGSA-N |
| XLogP | 6.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|