C21H29NO2S — CID 54306818
S-[3-(octylamino)-3-oxoprop-1-enyl] 4-phenylbut-3-enethioate (PubChem CID 54306818) has the molecular formula C21H29NO2S and a molecular weight of 359.54 g/mol. Its IUPAC name is S-[3-(octylamino)-3-oxoprop-1-enyl] 4-phenylbut-3-enethioate.
| Compound Name | S-[3-(octylamino)-3-oxoprop-1-enyl] 4-phenylbut-3-enethioate |
|---|---|
| PubChem CID | 54306818 |
| Molecular Formula | C21H29NO2S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | S-[3-(octylamino)-3-oxoprop-1-enyl] 4-phenylbut-3-enethioate |
| SMILES | CCCCCCCCNC(=O)C=CSC(=O)CC=Cc1ccccc1 |
| InChI | InChI=1S/C21H29NO2S/c1-2-3-4-5-6-10-17-22-20(23)16-18-25-21(24)15-11-14-19-12-8-7-9-13-19/h7-9,11-14,16,18H,2-6,10,15,17H2,1H3,(H,22,23) |
| InChIKey | SICPULBLBPEWMY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|