About S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate
S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate (PubChem CID 46854148) has the molecular formula C14H19NOS
and a molecular weight of 249.38 g/mol. Its IUPAC name is S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate.
Molecular Properties
| Compound Name | S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate |
| PubChem CID | 46854148 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate |
| SMILES | CCCCNC(=O)SC/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H19NOS/c1-2-3-11-15-14(16)17-12-7-10-13-8-5-4-6-9-13/h4-10H,2-3,11-12H2,1H3,(H,15,16)/b10-7+ |
| InChIKey | HUBMWYKVKQRPSK-JXMROGBWSA-N |
| XLogP | 3.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate?
The IUPAC name of S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate (CID 46854148) is S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate.
What is the SMILES notation for S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate?
The canonical SMILES for S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate is CCCCNC(=O)SC/C=C/c1ccccc1.
What is the InChIKey of S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate?
The InChIKey is HUBMWYKVKQRPSK-JXMROGBWSA-N. The full InChI is InChI=1S/C14H19NOS/c1-2-3-11-15-14(16)17-12-7-10-13-8-5-4-6-9-13/h4-10H,2-3,11-12H2,1H3,(H,15,16)/b10-7+.
What are the key properties of S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate?
S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate has a molecular weight of 249.38 g/mol, XLogP of 3.94, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(E)-3-phenylprop-2-enyl] N-butylcarbamothioate is sourced from PubChem (CID 46854148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).