C21H33N3O — CID 42702437
3-butyl-1-[(E)-3-phenylprop-2-enyl]-1-(2-piperidin-1-ylethyl)urea (PubChem CID 42702437) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 3-butyl-1-[(E)-3-phenylprop-2-enyl]-1-(2-piperidin-1-ylethyl)urea.
| Compound Name | 3-butyl-1-[(E)-3-phenylprop-2-enyl]-1-(2-piperidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 42702437 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 3-butyl-1-[(E)-3-phenylprop-2-enyl]-1-(2-piperidin-1-ylethyl)urea |
| SMILES | CCCCNC(=O)N(C/C=C/c1ccccc1)CCN1CCCCC1 |
| InChI | InChI=1S/C21H33N3O/c1-2-3-14-22-21(25)24(19-18-23-15-8-5-9-16-23)17-10-13-20-11-6-4-7-12-20/h4,6-7,10-13H,2-3,5,8-9,14-19H2,1H3,(H,22,25)/b13-10+ |
| InChIKey | NFTLMQWJPHHQAN-JLHYYAGUSA-N |
| XLogP | 4.00 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|