C24H38N2O — CID 42697019
N-[(E)-3-phenylprop-2-enyl]-N-(2-pyrrolidin-1-ylethyl)nonanamide (PubChem CID 42697019) has the molecular formula C24H38N2O and a molecular weight of 370.58 g/mol. Its IUPAC name is N-[(E)-3-phenylprop-2-enyl]-N-(2-pyrrolidin-1-ylethyl)nonanamide.
| Compound Name | N-[(E)-3-phenylprop-2-enyl]-N-(2-pyrrolidin-1-ylethyl)nonanamide |
|---|---|
| PubChem CID | 42697019 |
| Molecular Formula | C24H38N2O |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | N-[(E)-3-phenylprop-2-enyl]-N-(2-pyrrolidin-1-ylethyl)nonanamide |
| SMILES | CCCCCCCCC(=O)N(C/C=C/c1ccccc1)CCN1CCCC1 |
| InChI | InChI=1S/C24H38N2O/c1-2-3-4-5-6-10-17-24(27)26(22-21-25-18-11-12-19-25)20-13-16-23-14-8-7-9-15-23/h7-9,13-16H,2-6,10-12,17-22H2,1H3/b16-13+ |
| InChIKey | PSLXERARBZBIKX-DTQAZKPQSA-N |
| XLogP | 5.37 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|