C28H48N4O2 — CID 70962858
benzyl N-heptyl-N-[2-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]ethyl]carbamate (PubChem CID 70962858) has the molecular formula C28H48N4O2 and a molecular weight of 472.72 g/mol. Its IUPAC name is benzyl N-heptyl-N-[2-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]ethyl]carbamate.
| Compound Name | benzyl N-heptyl-N-[2-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 70962858 |
| Molecular Formula | C28H48N4O2 |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.38 |
| IUPAC Name | benzyl N-heptyl-N-[2-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]ethyl]carbamate |
| SMILES | CCCCCCCN(CCN1CCN(CCN2CCCCC2)CC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H48N4O2/c1-2-3-4-5-12-17-32(28(33)34-26-27-13-8-6-9-14-27)25-24-31-22-20-30(21-23-31)19-18-29-15-10-7-11-16-29/h6,8-9,13-14H,2-5,7,10-12,15-26H2,1H3 |
| InChIKey | RQIDGZLIPWECNQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|