C23H35N3O2 — CID 113123058
N-[3-oxo-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]propyl]-N-pentylacetamide (PubChem CID 113123058) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is N-[3-oxo-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]propyl]-N-pentylacetamide.
| Compound Name | N-[3-oxo-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]propyl]-N-pentylacetamide |
|---|---|
| PubChem CID | 113123058 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | N-[3-oxo-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]propyl]-N-pentylacetamide |
| SMILES | CCCCCN(CCC(=O)N1CCN(C/C=C/c2ccccc2)CC1)C(C)=O |
| InChI | InChI=1S/C23H35N3O2/c1-3-4-8-15-25(21(2)27)16-13-23(28)26-19-17-24(18-20-26)14-9-12-22-10-6-5-7-11-22/h5-7,9-12H,3-4,8,13-20H2,1-2H3/b12-9+ |
| InChIKey | CZXNOULSUCKBAN-FMIVXFBMSA-N |
| XLogP | 3.27 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|