C17H24N2OS — CID 6119188
(E)-N-(heptylcarbamothioyl)-3-phenylprop-2-enamide (PubChem CID 6119188) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is (E)-N-(heptylcarbamothioyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(heptylcarbamothioyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6119188 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (E)-N-(heptylcarbamothioyl)-3-phenylprop-2-enamide |
| SMILES | CCCCCCCNC(=S)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H24N2OS/c1-2-3-4-5-9-14-18-17(21)19-16(20)13-12-15-10-7-6-8-11-15/h6-8,10-13H,2-5,9,14H2,1H3,(H2,18,19,20,21)/b13-12+ |
| InChIKey | YVFHZEMEESGCGK-OUKQBFOZSA-N |
| XLogP | 3.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|