C12H12N2O3S — CID 139082096
2-[[(E)-3-phenylprop-2-enoyl]carbamothioylamino]acetic acid (PubChem CID 139082096) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-[[(E)-3-phenylprop-2-enoyl]carbamothioylamino]acetic acid.
| Compound Name | 2-[[(E)-3-phenylprop-2-enoyl]carbamothioylamino]acetic acid |
|---|---|
| PubChem CID | 139082096 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-[[(E)-3-phenylprop-2-enoyl]carbamothioylamino]acetic acid |
| SMILES | O=C(O)CNC(=S)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H12N2O3S/c15-10(14-12(18)13-8-11(16)17)7-6-9-4-2-1-3-5-9/h1-7H,8H2,(H,16,17)(H2,13,14,15,18)/b7-6+ |
| InChIKey | GAAYBFGIQRBLKD-VOTSOKGWSA-N |
| XLogP | 0.78 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|