C18H16N2O3S — CID 28688701
4-[[[(E)-3-phenylprop-2-enoyl]carbamothioylamino]methyl]benzoic acid (PubChem CID 28688701) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 4-[[[(E)-3-phenylprop-2-enoyl]carbamothioylamino]methyl]benzoic acid.
| Compound Name | 4-[[[(E)-3-phenylprop-2-enoyl]carbamothioylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 28688701 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 4-[[[(E)-3-phenylprop-2-enoyl]carbamothioylamino]methyl]benzoic acid |
| SMILES | O=C(/C=C/c1ccccc1)NC(=S)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H16N2O3S/c21-16(11-8-13-4-2-1-3-5-13)20-18(24)19-12-14-6-9-15(10-7-14)17(22)23/h1-11H,12H2,(H,22,23)(H2,19,20,21,24)/b11-8+ |
| InChIKey | MZZBVHVLZLGVSA-DHZHZOJOSA-N |
| XLogP | 2.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|