C21H26N2OS — CID 174617876
1,3-diphenylprop-2-en-1-one;pentylthiourea (PubChem CID 174617876) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is 1,3-diphenylprop-2-en-1-one;pentylthiourea.
| Compound Name | 1,3-diphenylprop-2-en-1-one;pentylthiourea |
|---|---|
| PubChem CID | 174617876 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1,3-diphenylprop-2-en-1-one;pentylthiourea |
| SMILES | CCCCCNC(N)=S.O=C(C=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O.C6H14N2S/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-2-3-4-5-8-6(7)9/h1-12H;2-5H2,1H3,(H3,7,8,9) |
| InChIKey | QDGITPHMOVQTAM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|