C10H19NO4 — CID 22445987
carbonic acid;N-hexylprop-2-enamide (PubChem CID 22445987) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is carbonic acid;N-hexylprop-2-enamide.
| Compound Name | carbonic acid;N-hexylprop-2-enamide |
|---|---|
| PubChem CID | 22445987 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | carbonic acid;N-hexylprop-2-enamide |
| SMILES | C=CC(=O)NCCCCCC.O=C(O)O |
| InChI | InChI=1S/C9H17NO.CH2O3/c1-3-5-6-7-8-10-9(11)4-2;2-1(3)4/h4H,2-3,5-8H2,1H3,(H,10,11);(H2,2,3,4) |
| InChIKey | OTPNNFFMLAIXMF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|