C26H50N2O2 — CID 138470318
N-ethenyl-N-methylacetamide;N-octadecylprop-2-enamide (PubChem CID 138470318) has the molecular formula C26H50N2O2 and a molecular weight of 422.70 g/mol. Its IUPAC name is N-ethenyl-N-methylacetamide;N-octadecylprop-2-enamide.
| Compound Name | N-ethenyl-N-methylacetamide;N-octadecylprop-2-enamide |
|---|---|
| PubChem CID | 138470318 |
| Molecular Formula | C26H50N2O2 |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.39 |
| IUPAC Name | N-ethenyl-N-methylacetamide;N-octadecylprop-2-enamide |
| SMILES | C=CC(=O)NCCCCCCCCCCCCCCCCCC.C=CN(C)C(C)=O |
| InChI | InChI=1S/C21H41NO.C5H9NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-21(23)4-2;1-4-6(3)5(2)7/h4H,2-3,5-20H2,1H3,(H,22,23);4H,1H2,2-3H3 |
| InChIKey | JOEKVMLNMVMZJW-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|