About N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide
N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide (PubChem CID 175049949) has the molecular formula C23H47BrN2O
and a molecular weight of 447.55 g/mol. Its IUPAC name is N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide.
Molecular Properties
| Compound Name | N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide |
| PubChem CID | 175049949 |
| Molecular Formula | C23H47BrN2O |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide |
| SMILES | Br.C=CC(=O)NCCNCCCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C23H46N2O.BrH/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-21-22-25-23(26)4-2;/h4,24H,2-3,5-22H2,1H3,(H,25,26);1H |
| InChIKey | NWLDVKNRRIBHCJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide?
The IUPAC name of N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide (CID 175049949) is N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide.
What is the SMILES notation for N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide?
The canonical SMILES for N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide is Br.C=CC(=O)NCCNCCCCCCCCCCCCCCCCCC.
What is the InChIKey of N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide?
The InChIKey is NWLDVKNRRIBHCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46N2O.BrH/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-21-22-25-23(26)4-2;/h4,24H,2-3,5-22H2,1H3,(H,25,26);1H.
What are the key properties of N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide?
N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide has a molecular weight of 447.55 g/mol, XLogP of 6.72, 21 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(octadecylamino)ethyl]prop-2-enamide;hydrobromide is sourced from PubChem (CID 175049949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).