C17H33N4O2+ — CID 123889341
methyl-[2-(prop-2-enoylamino)ethyl]-[3-[2-(prop-2-enoylamino)ethylamino]propyl]-propylazanium (PubChem CID 123889341) has the molecular formula C17H33N4O2+ and a molecular weight of 325.48 g/mol. Its IUPAC name is methyl-[2-(prop-2-enoylamino)ethyl]-[3-[2-(prop-2-enoylamino)ethylamino]propyl]-propylazanium.
| Compound Name | methyl-[2-(prop-2-enoylamino)ethyl]-[3-[2-(prop-2-enoylamino)ethylamino]propyl]-propylazanium |
|---|---|
| PubChem CID | 123889341 |
| Molecular Formula | C17H33N4O2+ |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | methyl-[2-(prop-2-enoylamino)ethyl]-[3-[2-(prop-2-enoylamino)ethylamino]propyl]-propylazanium |
| SMILES | C=CC(=O)NCCNCCC[N+](C)(CCC)CCNC(=O)C=C |
| InChI | InChI=1S/C17H32N4O2/c1-5-13-21(4,15-12-20-17(23)7-3)14-8-9-18-10-11-19-16(22)6-2/h6-7,18H,2-3,5,8-15H2,1,4H3,(H-,19,20,22,23)/p+1 |
| InChIKey | WUTMIRFZSCLJGV-UHFFFAOYSA-O |
| XLogP | 0.43 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|