About [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate
[1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate (PubChem CID 14362613) has the molecular formula C30H24O3
and a molecular weight of 432.52 g/mol. Its IUPAC name is [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate.
Molecular Properties
| Compound Name | [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate |
| PubChem CID | 14362613 |
| Molecular Formula | C30H24O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate |
| SMILES | CC[C@H](C(=O)Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C30H24O3/c1-2-23(20-10-4-3-5-11-20)30(32)33-27-19-17-22-13-7-9-15-25(22)29(27)28-24-14-8-6-12-21(24)16-18-26(28)31/h3-19,23,31H,2H2,1H3/t23-/m0/s1 |
| InChIKey | YHBJFSYTSWGRFV-QHCPKHFHSA-N |
| XLogP | 7.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate?
The IUPAC name of [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate (CID 14362613) is [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate.
What is the SMILES notation for [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate?
The canonical SMILES for [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate is CC[C@H](C(=O)Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12)c1ccccc1.
What is the InChIKey of [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate?
The InChIKey is YHBJFSYTSWGRFV-QHCPKHFHSA-N. The full InChI is InChI=1S/C30H24O3/c1-2-23(20-10-4-3-5-11-20)30(32)33-27-19-17-22-13-7-9-15-25(22)29(27)28-24-14-8-6-12-21(24)16-18-26(28)31/h3-19,23,31H,2H2,1H3/t23-/m0/s1.
What are the key properties of [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate?
[1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate has a molecular weight of 432.52 g/mol, XLogP of 7.46, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] (2S)-2-phenylbutanoate is sourced from PubChem (CID 14362613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).