C17H20O9 — CID 163194771
trans-methyl (3R,5R)-1-[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3,4,5-trihydroxycyclohexane-1-carboxylate (PubChem CID 163194771) has the molecular formula C17H20O9 and a molecular weight of 368.34 g/mol. Its IUPAC name is trans-methyl (3R,5R)-1-[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3,4,5-trihydroxycyclohexane-1-carboxylate.
| Compound Name | trans-methyl (3R,5R)-1-[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3,4,5-trihydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 163194771 |
| Molecular Formula | C17H20O9 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | trans-methyl (3R,5R)-1-[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3,4,5-trihydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(OC(=O)/C=C\c2ccc(O)c(O)c2)C[C@@H](O)C(O)[C@H](O)C1 |
| InChI | InChI=1S/C17H20O9/c1-25-16(24)17(7-12(20)15(23)13(21)8-17)26-14(22)5-3-9-2-4-10(18)11(19)6-9/h2-6,12-13,15,18-21,23H,7-8H2,1H3/b5-3-/t12-,13-,15?,17?/m1/s1 |
| InChIKey | YKLASSTYJKBGIY-YMICSQMHSA-N |
| XLogP | -0.56 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|