C17H21NO8 — CID 25017117
[(1R,2S,3R,5R)-2,3,5-trihydroxy-5-(methylcarbamoyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 25017117) has the molecular formula C17H21NO8 and a molecular weight of 367.35 g/mol. Its IUPAC name is [(1R,2S,3R,5R)-2,3,5-trihydroxy-5-(methylcarbamoyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(1R,2S,3R,5R)-2,3,5-trihydroxy-5-(methylcarbamoyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 25017117 |
| Molecular Formula | C17H21NO8 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | [(1R,2S,3R,5R)-2,3,5-trihydroxy-5-(methylcarbamoyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CNC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@H](OC(=O)/C=C/c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C17H21NO8/c1-18-16(24)17(25)7-12(21)15(23)13(8-17)26-14(22)5-3-9-2-4-10(19)11(20)6-9/h2-6,12-13,15,19-21,23,25H,7-8H2,1H3,(H,18,24)/b5-3+/t12-,13-,15+,17-/m1/s1 |
| InChIKey | LGJOLQOPJFAIMB-NYCIAPANSA-N |
| XLogP | -0.98 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|