C19H23NO8 — CID 59364399
[(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2,3,5-trihydroxycyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 59364399) has the molecular formula C19H23NO8 and a molecular weight of 393.39 g/mol. Its IUPAC name is [(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2,3,5-trihydroxycyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2,3,5-trihydroxycyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 59364399 |
| Molecular Formula | C19H23NO8 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2,3,5-trihydroxycyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C[C@](O)(C(=O)NC2CC2)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H23NO8/c21-12-5-1-10(7-13(12)22)2-6-16(24)28-15-9-19(27,8-14(23)17(15)25)18(26)20-11-3-4-11/h1-2,5-7,11,14-15,17,21-23,25,27H,3-4,8-9H2,(H,20,26)/b6-2+/t14-,15-,17-,19+/m1/s1 |
| InChIKey | BQRMRJUXRYKZGL-OXQKCYHSSA-N |
| XLogP | -0.45 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|