C29H31NO11 — CID 90145785
[(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3,5-dihydroxycyclohexyl] (E)-4-(3,4-dihydroxyphenyl)but-2-enoate (PubChem CID 90145785) has the molecular formula C29H31NO11 and a molecular weight of 569.56 g/mol. Its IUPAC name is [(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3,5-dihydroxycyclohexyl] (E)-4-(3,4-dihydroxyphenyl)but-2-enoate.
| Compound Name | [(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3,5-dihydroxycyclohexyl] (E)-4-(3,4-dihydroxyphenyl)but-2-enoate |
|---|---|
| PubChem CID | 90145785 |
| Molecular Formula | C29H31NO11 |
| Molecular Weight | 569.56 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | [(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3,5-dihydroxycyclohexyl] (E)-4-(3,4-dihydroxyphenyl)but-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1[C@H](O)C[C@@](O)(C(=O)NC2CC2)C[C@H]1OC(=O)/C=C/Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C29H31NO11/c31-19-9-4-16(12-21(19)33)2-1-3-25(36)40-24-15-29(39,28(38)30-18-7-8-18)14-23(35)27(24)41-26(37)11-6-17-5-10-20(32)22(34)13-17/h1,3-6,9-13,18,23-24,27,31-35,39H,2,7-8,14-15H2,(H,30,38)/b3-1+,11-6+/t23-,24-,27-,29+/m1/s1 |
| InChIKey | AGOQEGYIPRMFEH-RHYOLJHXSA-N |
| XLogP | 1.31 |
| TPSA | 203.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.56 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|