C28H29NO11 — CID 91333625
[(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,5-dihydroxycyclohexyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 91333625) has the molecular formula C28H29NO11 and a molecular weight of 555.54 g/mol. Its IUPAC name is [(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,5-dihydroxycyclohexyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,5-dihydroxycyclohexyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 91333625 |
| Molecular Formula | C28H29NO11 |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | [(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,5-dihydroxycyclohexyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)O[C@@H]1[C@H](O)C[C@@](O)(C(=O)NC2CC2)C[C@H]1OC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C28H29NO11/c30-18-7-1-15(11-20(18)32)3-9-24(35)39-23-14-28(38,27(37)29-17-5-6-17)13-22(34)26(23)40-25(36)10-4-16-2-8-19(31)21(33)12-16/h1-4,7-12,17,22-23,26,30-34,38H,5-6,13-14H2,(H,29,37)/t22-,23-,26-,28+/m1/s1 |
| InChIKey | MWWBPVSHAIEQFQ-ZROLIBMPSA-N |
| XLogP | 1.22 |
| TPSA | 203.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|