C18H20O10 — CID 171318625
4-acetyloxy-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,5-dihydroxycyclohexane-1-carboxylic acid (PubChem CID 171318625) has the molecular formula C18H20O10 and a molecular weight of 396.35 g/mol. Its IUPAC name is 4-acetyloxy-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,5-dihydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-acetyloxy-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,5-dihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171318625 |
| Molecular Formula | C18H20O10 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 4-acetyloxy-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,5-dihydroxycyclohexane-1-carboxylic acid |
| SMILES | CC(=O)OC1C(O)CC(O)(C(=O)O)CC1OC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H20O10/c1-9(19)27-16-13(22)7-18(26,17(24)25)8-14(16)28-15(23)5-3-10-2-4-11(20)12(21)6-10/h2-6,13-14,16,20-22,26H,7-8H2,1H3,(H,24,25)/b5-3+ |
| InChIKey | BRMYXJWXTCELRG-HWKANZROSA-N |
| XLogP | -0.08 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|