C26H26O11 — CID 148586560
(1S,3R,4R,5R)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3-dihydroxy-5-[(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid (PubChem CID 148586560) has the molecular formula C26H26O11 and a molecular weight of 514.48 g/mol. Its IUPAC name is (1S,3R,4R,5R)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3-dihydroxy-5-[(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid.
| Compound Name | (1S,3R,4R,5R)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3-dihydroxy-5-[(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 148586560 |
| Molecular Formula | C26H26O11 |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | (1S,3R,4R,5R)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3-dihydroxy-5-[(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(/C=C/C(=O)O[C@@H]2C[C@](O)(C(=O)O)C[C@@H](O)[C@H]2OC(=O)/C=C/c2ccc(O)c(O)c2)cc1O |
| InChI | InChI=1S/C26H26O11/c1-14-2-3-15(10-18(14)28)5-8-22(31)36-21-13-26(35,25(33)34)12-20(30)24(21)37-23(32)9-6-16-4-7-17(27)19(29)11-16/h2-11,20-21,24,27-30,35H,12-13H2,1H3,(H,33,34)/b8-5+,9-6+/t20-,21-,24-,26+/m1/s1 |
| InChIKey | MZUVNWKXUPSTBO-QFEIBKNHSA-N |
| XLogP | 1.63 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|